C30H46N+ — CID 123272027
2-[1-[1-ethyl-5-(2,2,3-trimethylheptyl)-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]ethyl]-1-azoniacyclobuta-1,4-diene (PubChem CID 123272027) has the molecular formula C30H46N+ and a molecular weight of 420.71 g/mol. Its IUPAC name is 2-[1-[1-ethyl-5-(2,2,3-trimethylheptyl)-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]ethyl]-1-azoniacyclobuta-1,4-diene.
| Compound Name | 2-[1-[1-ethyl-5-(2,2,3-trimethylheptyl)-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]ethyl]-1-azoniacyclobuta-1,4-diene |
|---|---|
| PubChem CID | 123272027 |
| Molecular Formula | C30H46N+ |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | 2-[1-[1-ethyl-5-(2,2,3-trimethylheptyl)-2,3,7,8,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]ethyl]-1-azoniacyclobuta-1,4-diene |
| SMILES | CCCCC(C)C(C)(C)CC1=CC2=C(C(CC)CC2C(C)C2=[N+]=CC2)C2CCCC=C12 |
| InChI | InChI=1S/C30H46N/c1-7-9-12-20(3)30(5,6)19-23-18-27-26(21(4)28-15-16-31-28)17-22(8-2)29(27)25-14-11-10-13-24(23)25/h13,16,18,20-22,25-26H,7-12,14-15,17,19H2,1-6H3/q+1 |
| InChIKey | SFKYOJYKKUZQAS-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|