C27H35N — CID 143465565
(Z)-1-[3-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-4-methylidene-8,8a-dihydro-1H-naphthalen-1-yl]-N-ethylhex-3-en-2-imine (PubChem CID 143465565) has the molecular formula C27H35N and a molecular weight of 373.58 g/mol. Its IUPAC name is (Z)-1-[3-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-4-methylidene-8,8a-dihydro-1H-naphthalen-1-yl]-N-ethylhex-3-en-2-imine.
| Compound Name | (Z)-1-[3-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-4-methylidene-8,8a-dihydro-1H-naphthalen-1-yl]-N-ethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 143465565 |
| Molecular Formula | C27H35N |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (Z)-1-[3-[(3E)-3-ethenylhexa-1,3-dien-2-yl]-4-methylidene-8,8a-dihydro-1H-naphthalen-1-yl]-N-ethylhex-3-en-2-imine |
| SMILES | C=C/C(=C\CC)C(=C)C1=CC(CC(/C=C\CC)=N/CC)C2CC=CC=C2C1=C |
| InChI | InChI=1S/C27H35N/c1-7-11-15-24(28-10-4)18-23-19-27(20(5)22(9-3)14-8-2)21(6)25-16-12-13-17-26(23)25/h9,11-16,19,23,26H,3,5-8,10,17-18H2,1-2,4H3/b15-11-,22-14+,28-24+ |
| InChIKey | SRESUDLHXZIEFA-ZMWLWGGASA-N |
| XLogP | 7.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|