C32H54N2 — CID 101455051
1-N,2-N-ditert-butyl-3-[2-(2-tert-butyl-6,6-dimethylhepta-3,4-dienyl)-3,4,5-trimethylcyclopenta-2,4-dien-1-yl]propane-1,2-diimine (PubChem CID 101455051) has the molecular formula C32H54N2 and a molecular weight of 466.80 g/mol. Its IUPAC name is 1-N,2-N-ditert-butyl-3-[2-(2-tert-butyl-6,6-dimethylhepta-3,4-dienyl)-3,4,5-trimethylcyclopenta-2,4-dien-1-yl]propane-1,2-diimine.
| Compound Name | 1-N,2-N-ditert-butyl-3-[2-(2-tert-butyl-6,6-dimethylhepta-3,4-dienyl)-3,4,5-trimethylcyclopenta-2,4-dien-1-yl]propane-1,2-diimine |
|---|---|
| PubChem CID | 101455051 |
| Molecular Formula | C32H54N2 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.43 |
| IUPAC Name | 1-N,2-N-ditert-butyl-3-[2-(2-tert-butyl-6,6-dimethylhepta-3,4-dienyl)-3,4,5-trimethylcyclopenta-2,4-dien-1-yl]propane-1,2-diimine |
| SMILES | CC1=C(C)C(CC(/C=N/C(C)(C)C)=N/C(C)(C)C)C(CC(C=C=CC(C)(C)C)C(C)(C)C)=C1C |
| InChI | InChI=1S/C32H54N2/c1-22-23(2)27(19-25(30(7,8)9)17-16-18-29(4,5)6)28(24(22)3)20-26(34-32(13,14)15)21-33-31(10,11)12/h17-18,21,25,28H,19-20H2,1-15H3/b33-21+,34-26- |
| InChIKey | YFBVNZSUEQHLPT-CTBXFCJJSA-N |
| XLogP | 9.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|