C31H57N — CID 142530222
1-[(3R,5E)-3,4-dimethyl-5-pentan-2-ylidenecyclopenten-1-yl]-N-(2-methylprop-1-enyl)ethanimine;5-ethyl-5-methyldecane (PubChem CID 142530222) has the molecular formula C31H57N and a molecular weight of 443.80 g/mol. Its IUPAC name is 1-[(3R,5E)-3,4-dimethyl-5-pentan-2-ylidenecyclopenten-1-yl]-N-(2-methylprop-1-enyl)ethanimine;5-ethyl-5-methyldecane.
| Compound Name | 1-[(3R,5E)-3,4-dimethyl-5-pentan-2-ylidenecyclopenten-1-yl]-N-(2-methylprop-1-enyl)ethanimine;5-ethyl-5-methyldecane |
|---|---|
| PubChem CID | 142530222 |
| Molecular Formula | C31H57N |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.45 |
| IUPAC Name | 1-[(3R,5E)-3,4-dimethyl-5-pentan-2-ylidenecyclopenten-1-yl]-N-(2-methylprop-1-enyl)ethanimine;5-ethyl-5-methyldecane |
| SMILES | CCC/C(C)=C1/C(/C(C)=N/C=C(C)C)=C[C@@H](C)C1C.CCCCCC(C)(CC)CCCC |
| InChI | InChI=1S/C18H29N.C13H28/c1-8-9-13(4)18-15(6)14(5)10-17(18)16(7)19-11-12(2)3;1-5-8-10-12-13(4,7-3)11-9-6-2/h10-11,14-15H,8-9H2,1-7H3;5-12H2,1-4H3/b18-13+,19-16+;/t14-,15?;/m1./s1 |
| InChIKey | DKTSQUPDNSURRG-XPYRBWLVSA-N |
| XLogP | 10.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|