C20H39N — CID 123850959
(E)-N,3,6,11,11,13-hexamethyltetradec-2-en-4-imine (PubChem CID 123850959) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is (E)-N,3,6,11,11,13-hexamethyltetradec-2-en-4-imine.
| Compound Name | (E)-N,3,6,11,11,13-hexamethyltetradec-2-en-4-imine |
|---|---|
| PubChem CID | 123850959 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | (E)-N,3,6,11,11,13-hexamethyltetradec-2-en-4-imine |
| SMILES | C/C=C(C)/C(CC(C)CCCCC(C)(C)CC(C)C)=N\C |
| InChI | InChI=1S/C20H39N/c1-9-18(5)19(21-8)14-17(4)12-10-11-13-20(6,7)15-16(2)3/h9,16-17H,10-15H2,1-8H3/b18-9+,21-19- |
| InChIKey | AYOANJMAXIFXSY-INKSWTDTSA-N |
| XLogP | 6.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|