C31H50N2 — CID 143392002
1-N,2-N,5-trimethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohex-3-ene-1,2-diimine (PubChem CID 143392002) has the molecular formula C31H50N2 and a molecular weight of 450.76 g/mol. Its IUPAC name is 1-N,2-N,5-trimethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohex-3-ene-1,2-diimine.
| Compound Name | 1-N,2-N,5-trimethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 143392002 |
| Molecular Formula | C31H50N2 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 450.40 |
| IUPAC Name | 1-N,2-N,5-trimethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohex-3-ene-1,2-diimine |
| SMILES | CCC(C)(C)/C(C)=C/C=C(\C)C1=CC(C)C(/C(C)=C/C=C(\C)C(C)(C)CC)C(=N/C)/C1=N/C |
| InChI | InChI=1S/C31H50N2/c1-14-30(8,9)24(6)18-16-21(3)26-20-23(5)27(29(33-13)28(26)32-12)22(4)17-19-25(7)31(10,11)15-2/h16-20,23,27H,14-15H2,1-13H3/b21-16+,22-17+,24-18+,25-19+,32-28+,33-29- |
| InChIKey | IQXXAMBZHPBTJT-KDOPAVTQSA-N |
| XLogP | 8.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|