C29H36N2 — CID 143756614
ethane;(Z)-N-ethyl-2-[7-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-3aH-indol-3-yl]but-2-en-1-imine (PubChem CID 143756614) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is ethane;(Z)-N-ethyl-2-[7-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-3aH-indol-3-yl]but-2-en-1-imine.
| Compound Name | ethane;(Z)-N-ethyl-2-[7-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-3aH-indol-3-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 143756614 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | ethane;(Z)-N-ethyl-2-[7-[1-(3-methyl-2,3-dihydronaphthalen-1-yl)ethyl]-3aH-indol-3-yl]but-2-en-1-imine |
| SMILES | C/C=C(\C=N\CC)C1=CN=C2C(C(C)C3=c4ccccc4=CC(C)C3)=CC=CC12.CC |
| InChI | InChI=1S/C27H30N2.C2H6/c1-5-20(16-28-6-2)26-17-29-27-22(12-9-13-24(26)27)19(4)25-15-18(3)14-21-10-7-8-11-23(21)25;1-2/h5,7-14,16-19,24H,6,15H2,1-4H3;1-2H3/b20-5+,28-16+; |
| InChIKey | VYLOYUZZAQLPCZ-OVQXAKHOSA-N |
| XLogP | 5.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|