C18H21N — CID 140979488
3-cyclohex-2-en-1-yl-4,4-dimethyl-6-methylidenequinoline (PubChem CID 140979488) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-4,4-dimethyl-6-methylidenequinoline.
| Compound Name | 3-cyclohex-2-en-1-yl-4,4-dimethyl-6-methylidenequinoline |
|---|---|
| PubChem CID | 140979488 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-4,4-dimethyl-6-methylidenequinoline |
| SMILES | C=c1ccc2c(c1)C(C)(C)C(C1C=CCCC1)=CN=2 |
| InChI | InChI=1S/C18H21N/c1-13-9-10-17-15(11-13)18(2,3)16(12-19-17)14-7-5-4-6-8-14/h5,7,9-12,14H,1,4,6,8H2,2-3H3 |
| InChIKey | HGJRQIYWVOBJPO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|