C23H35N — CID 123417329
4-(4,7a-dimethyl-1,2,3,3a,4,7-hexahydroinden-1-yl)-2-propan-2-ylidene-N-propylhexa-3,5-dien-1-imine (PubChem CID 123417329) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is 4-(4,7a-dimethyl-1,2,3,3a,4,7-hexahydroinden-1-yl)-2-propan-2-ylidene-N-propylhexa-3,5-dien-1-imine.
| Compound Name | 4-(4,7a-dimethyl-1,2,3,3a,4,7-hexahydroinden-1-yl)-2-propan-2-ylidene-N-propylhexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 123417329 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 4-(4,7a-dimethyl-1,2,3,3a,4,7-hexahydroinden-1-yl)-2-propan-2-ylidene-N-propylhexa-3,5-dien-1-imine |
| SMILES | C=CC(=CC(/C=N/CCC)=C(C)C)C1CCC2C(C)C=CCC12C |
| InChI | InChI=1S/C23H35N/c1-7-14-24-16-20(17(3)4)15-19(8-2)22-12-11-21-18(5)10-9-13-23(21,22)6/h8-10,15-16,18,21-22H,2,7,11-14H2,1,3-6H3/b19-15?,24-16+ |
| InChIKey | QBLIGVJWHGVYMN-OOJSMXQESA-N |
| XLogP | 6.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|