C20H35N — CID 123574516
N-ethyl-2-ethylidene-4-(2-ethyl-2,3,3-trimethylcyclopentyl)hex-3-en-1-imine (PubChem CID 123574516) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-ethyl-2-ethylidene-4-(2-ethyl-2,3,3-trimethylcyclopentyl)hex-3-en-1-imine.
| Compound Name | N-ethyl-2-ethylidene-4-(2-ethyl-2,3,3-trimethylcyclopentyl)hex-3-en-1-imine |
|---|---|
| PubChem CID | 123574516 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-ethyl-2-ethylidene-4-(2-ethyl-2,3,3-trimethylcyclopentyl)hex-3-en-1-imine |
| SMILES | CC=C(C=C(CC)C1CCC(C)(C)C1(C)CC)/C=N/CC |
| InChI | InChI=1S/C20H35N/c1-8-16(15-21-11-4)14-17(9-2)18-12-13-19(5,6)20(18,7)10-3/h8,14-15,18H,9-13H2,1-7H3/b16-8?,17-14?,21-15+ |
| InChIKey | IKCQUBRVAZKRQW-WQTJYYBBSA-N |
| XLogP | 6.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|