C32H47N — CID 90908706
N-ethyl-2-propan-2-ylidene-4-(6,8,16-trimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dienyl)hexa-3,5-dien-1-imine (PubChem CID 90908706) has the molecular formula C32H47N and a molecular weight of 445.74 g/mol. Its IUPAC name is N-ethyl-2-propan-2-ylidene-4-(6,8,16-trimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dienyl)hexa-3,5-dien-1-imine.
| Compound Name | N-ethyl-2-propan-2-ylidene-4-(6,8,16-trimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dienyl)hexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 90908706 |
| Molecular Formula | C32H47N |
| Molecular Weight | 445.74 g/mol |
| Exact Mass | 445.37 |
| IUPAC Name | N-ethyl-2-propan-2-ylidene-4-(6,8,16-trimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1,3-dienyl)hexa-3,5-dien-1-imine |
| SMILES | C=CC(=CC(/C=N/CC)=C(C)C)C1CCC2C3CCC4(C)CC(C)CC=C4C=C3CCC12C |
| InChI | InChI=1S/C32H47N/c1-8-24(18-26(22(3)4)21-33-9-2)29-12-13-30-28-15-16-31(6)20-23(5)10-11-27(31)19-25(28)14-17-32(29,30)7/h8,11,18-19,21,23,28-30H,1,9-10,12-17,20H2,2-7H3/b24-18?,33-21+ |
| InChIKey | HEWSOJBYYOZFRU-OZACCFLOSA-N |
| XLogP | 9.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.74 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|