C37H62N2 — CID 155751164
ethane;16-ethyl-2,5,5-trimethyl-15-(4-methylpent-1-en-2-yl)tetracyclo[9.7.0.02,8.012,16]octadec-8-ene;(E)-2-(methyliminomethyl)but-2-enenitrile (PubChem CID 155751164) has the molecular formula C37H62N2 and a molecular weight of 534.92 g/mol. Its IUPAC name is ethane;16-ethyl-2,5,5-trimethyl-15-(4-methylpent-1-en-2-yl)tetracyclo[9.7.0.02,8.012,16]octadec-8-ene;(E)-2-(methyliminomethyl)but-2-enenitrile.
| Compound Name | ethane;16-ethyl-2,5,5-trimethyl-15-(4-methylpent-1-en-2-yl)tetracyclo[9.7.0.02,8.012,16]octadec-8-ene;(E)-2-(methyliminomethyl)but-2-enenitrile |
|---|---|
| PubChem CID | 155751164 |
| Molecular Formula | C37H62N2 |
| Molecular Weight | 534.92 g/mol |
| Exact Mass | 534.49 |
| IUPAC Name | ethane;16-ethyl-2,5,5-trimethyl-15-(4-methylpent-1-en-2-yl)tetracyclo[9.7.0.02,8.012,16]octadec-8-ene;(E)-2-(methyliminomethyl)but-2-enenitrile |
| SMILES | C/C=C(C#N)\C=N\C.C=C(CC(C)C)C1CCC2C3CC=C4CCC(C)(C)CCC4(C)C3CCC12CC.CC |
| InChI | InChI=1S/C29H48.C6H8N2.C2H6/c1-8-29-16-14-25-23(26(29)12-11-24(29)21(4)19-20(2)3)10-9-22-13-15-27(5,6)17-18-28(22,25)7;1-3-6(4-7)5-8-2;1-2/h9,20,23-26H,4,8,10-19H2,1-3,5-7H3;3,5H,1-2H3;1-2H3/b;6-3-,8-5+; |
| InChIKey | QCTNHUHARQONNI-ZVFCCJOESA-N |
| XLogP | 11.16 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.92 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|