C39H68N+ — CID 155751407
1,3-diethylazet-1-ium;ethane;(5S)-16-ethyl-2,5-dimethyl-15-pent-1-en-2-yl-5-propyltetracyclo[9.7.0.02,8.012,16]octadec-8-ene (PubChem CID 155751407) has the molecular formula C39H68N+ and a molecular weight of 550.98 g/mol. Its IUPAC name is 1,3-diethylazet-1-ium;ethane;(5S)-16-ethyl-2,5-dimethyl-15-pent-1-en-2-yl-5-propyltetracyclo[9.7.0.02,8.012,16]octadec-8-ene.
| Compound Name | 1,3-diethylazet-1-ium;ethane;(5S)-16-ethyl-2,5-dimethyl-15-pent-1-en-2-yl-5-propyltetracyclo[9.7.0.02,8.012,16]octadec-8-ene |
|---|---|
| PubChem CID | 155751407 |
| Molecular Formula | C39H68N+ |
| Molecular Weight | 550.98 g/mol |
| Exact Mass | 550.53 |
| IUPAC Name | 1,3-diethylazet-1-ium;ethane;(5S)-16-ethyl-2,5-dimethyl-15-pent-1-en-2-yl-5-propyltetracyclo[9.7.0.02,8.012,16]octadec-8-ene |
| SMILES | C=C(CCC)C1CCC2C3CC=C4CC[C@](C)(CCC)CCC4(C)C3CCC12CC.CC.CCC1=C[N+](CC)=C1 |
| InChI | InChI=1S/C30H50.C7H12N.C2H6/c1-7-10-22(4)25-13-14-27-24-12-11-23-15-18-28(5,17-8-2)20-21-29(23,6)26(24)16-19-30(25,27)9-3;1-3-7-5-8(4-2)6-7;1-2/h11,24-27H,4,7-10,12-21H2,1-3,5-6H3;5-6H,3-4H2,1-2H3;1-2H3/q;+1;/t24?,25?,26?,27?,28-,29?,30?;;/m0../s1 |
| InChIKey | IGTKVBRYSTVRCP-ICIIHXJZSA-N |
| XLogP | 11.93 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.98 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|