C28H41N — CID 153335286
(2E)-2-[(Z)-prop-1-enyl]-3-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-2,4-dien-1-imine (PubChem CID 153335286) has the molecular formula C28H41N and a molecular weight of 391.64 g/mol. Its IUPAC name is (2E)-2-[(Z)-prop-1-enyl]-3-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-2,4-dien-1-imine.
| Compound Name | (2E)-2-[(Z)-prop-1-enyl]-3-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 153335286 |
| Molecular Formula | C28H41N |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | (2E)-2-[(Z)-prop-1-enyl]-3-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(/C=C\C)=C(\C=C)C1CCC2C3CC=C4CC(C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H41N/c1-6-8-20(18-29)22(7-2)24-11-12-25-23-10-9-21-17-19(3)13-15-27(21,4)26(23)14-16-28(24,25)5/h6-9,18-19,23-26,29H,2,10-17H2,1,3-5H3/b8-6-,22-20+,29-18+ |
| InChIKey | HJMAKYCBTFDKHN-RJDWWASYSA-N |
| XLogP | 7.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|