C28H43N — CID 162382714
methane;(2Z)-5-(13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2-prop-2-enylidenehex-5-en-1-imine (PubChem CID 162382714) has the molecular formula C28H43N and a molecular weight of 393.66 g/mol. Its IUPAC name is methane;(2Z)-5-(13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2-prop-2-enylidenehex-5-en-1-imine.
| Compound Name | methane;(2Z)-5-(13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2-prop-2-enylidenehex-5-en-1-imine |
|---|---|
| PubChem CID | 162382714 |
| Molecular Formula | C28H43N |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | methane;(2Z)-5-(13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2-prop-2-enylidenehex-5-en-1-imine |
| SMILES | C.[H]/N=C/C(=C\C=C)CCC(=C)C1CCC2C3CC=C4CCCCC4C3CCC12C |
| InChI | InChI=1S/C27H39N.CH4/c1-4-7-20(18-28)11-10-19(2)25-14-15-26-24-13-12-21-8-5-6-9-22(21)23(24)16-17-27(25,26)3;/h4,7,12,18,22-26,28H,1-2,5-6,8-11,13-17H2,3H3;1H4/b20-7-,28-18+; |
| InChIKey | IMUIOCDEHIXUOB-AGWSOEQSSA-N |
| XLogP | 8.30 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|