C17H23N — CID 130217410
1-[(7Z)-2,3-diethyl-7-ethylidene-2,3-dihydroinden-1-yl]-N-methylmethanimine (PubChem CID 130217410) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[(7Z)-2,3-diethyl-7-ethylidene-2,3-dihydroinden-1-yl]-N-methylmethanimine.
| Compound Name | 1-[(7Z)-2,3-diethyl-7-ethylidene-2,3-dihydroinden-1-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 130217410 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-[(7Z)-2,3-diethyl-7-ethylidene-2,3-dihydroinden-1-yl]-N-methylmethanimine |
| SMILES | C/C=c1/cccc2c1=C(/C=N/C)C(CC)C2CC |
| InChI | InChI=1S/C17H23N/c1-5-12-9-8-10-15-13(6-2)14(7-3)16(11-18-4)17(12)15/h5,8-11,13-14H,6-7H2,1-4H3/b12-5-,18-11+ |
| InChIKey | FZMFLVYBZJOTMH-KEZNQCDLSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|