C18H28N+ — CID 123307918
8-hexyl-2,9-dimethyl-9,9a-dihydro-3H-2-benzazepin-2-ium (PubChem CID 123307918) has the molecular formula C18H28N+ and a molecular weight of 258.43 g/mol. Its IUPAC name is 8-hexyl-2,9-dimethyl-9,9a-dihydro-3H-2-benzazepin-2-ium.
| Compound Name | 8-hexyl-2,9-dimethyl-9,9a-dihydro-3H-2-benzazepin-2-ium |
|---|---|
| PubChem CID | 123307918 |
| Molecular Formula | C18H28N+ |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 8-hexyl-2,9-dimethyl-9,9a-dihydro-3H-2-benzazepin-2-ium |
| SMILES | CCCCCCC1=CC=C2C=CC[N+](C)=CC2C1C |
| InChI | InChI=1S/C18H28N/c1-4-5-6-7-9-16-11-12-17-10-8-13-19(3)14-18(17)15(16)2/h8,10-12,14-15,18H,4-7,9,13H2,1-3H3/q+1 |
| InChIKey | DHSFEIBRVZPIRX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|