C18H26FN — CID 155724042
N-ethyl-1-[5-(6-fluoro-2-methylcyclohex-2-en-1-yl)-2-methylcyclohepta-1,3-dien-1-yl]methanimine (PubChem CID 155724042) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is N-ethyl-1-[5-(6-fluoro-2-methylcyclohex-2-en-1-yl)-2-methylcyclohepta-1,3-dien-1-yl]methanimine.
| Compound Name | N-ethyl-1-[5-(6-fluoro-2-methylcyclohex-2-en-1-yl)-2-methylcyclohepta-1,3-dien-1-yl]methanimine |
|---|---|
| PubChem CID | 155724042 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-ethyl-1-[5-(6-fluoro-2-methylcyclohex-2-en-1-yl)-2-methylcyclohepta-1,3-dien-1-yl]methanimine |
| SMILES | CC/N=C/C1=C(C)C=CC(C2C(C)=CCCC2F)CC1 |
| InChI | InChI=1S/C18H26FN/c1-4-20-12-16-11-10-15(9-8-13(16)2)18-14(3)6-5-7-17(18)19/h6,8-9,12,15,17-18H,4-5,7,10-11H2,1-3H3/b20-12+ |
| InChIKey | BRPWDMMNBFTMOI-UDWIEESQSA-N |
| XLogP | 5.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|