C14H18FN — CID 143931828
5-[(5-fluorocyclohepta-2,5-dien-1-yl)methyl]-3-methyl-2,3-dihydropyridine (PubChem CID 143931828) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is 5-[(5-fluorocyclohepta-2,5-dien-1-yl)methyl]-3-methyl-2,3-dihydropyridine.
| Compound Name | 5-[(5-fluorocyclohepta-2,5-dien-1-yl)methyl]-3-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143931828 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-[(5-fluorocyclohepta-2,5-dien-1-yl)methyl]-3-methyl-2,3-dihydropyridine |
| SMILES | CC1C=C(CC2C=CCC(F)=CC2)C=NC1 |
| InChI | InChI=1S/C14H18FN/c1-11-7-13(10-16-9-11)8-12-3-2-4-14(15)6-5-12/h2-3,6-7,10-12H,4-5,8-9H2,1H3 |
| InChIKey | UIOBTKACGNCYGW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|