C10H18FN — CID 129037792
(Z,5S)-N-ethyl-5-fluoro-6-methylhept-2-en-1-imine (PubChem CID 129037792) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (Z,5S)-N-ethyl-5-fluoro-6-methylhept-2-en-1-imine.
| Compound Name | (Z,5S)-N-ethyl-5-fluoro-6-methylhept-2-en-1-imine |
|---|---|
| PubChem CID | 129037792 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (Z,5S)-N-ethyl-5-fluoro-6-methylhept-2-en-1-imine |
| SMILES | CC/N=C/C=C\C[C@H](F)C(C)C |
| InChI | InChI=1S/C10H18FN/c1-4-12-8-6-5-7-10(11)9(2)3/h5-6,8-10H,4,7H2,1-3H3/b6-5-,12-8+/t10-/m0/s1 |
| InChIKey | UEQLJHFPSXXUCC-FVPWPNDESA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|