C17H26FN — CID 101404446
(2Z,4E,6E,8E)-10-ethyl-2-fluoro-N,3,7-trimethyldodeca-2,4,6,8-tetraen-1-imine (PubChem CID 101404446) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-10-ethyl-2-fluoro-N,3,7-trimethyldodeca-2,4,6,8-tetraen-1-imine.
| Compound Name | (2Z,4E,6E,8E)-10-ethyl-2-fluoro-N,3,7-trimethyldodeca-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 101404446 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (2Z,4E,6E,8E)-10-ethyl-2-fluoro-N,3,7-trimethyldodeca-2,4,6,8-tetraen-1-imine |
| SMILES | CCC(/C=C/C(C)=C/C=C/C(C)=C(F)/C=N/C)CC |
| InChI | InChI=1S/C17H26FN/c1-6-16(7-2)12-11-14(3)9-8-10-15(4)17(18)13-19-5/h8-13,16H,6-7H2,1-5H3/b10-8+,12-11+,14-9+,17-15-,19-13+ |
| InChIKey | FAKKHMAIQQDCFD-MBOJYYAMSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|