C8H14FN — CID 155728645
(Z)-N,4-dimethylhex-2-enimidoyl fluoride (PubChem CID 155728645) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z)-N,4-dimethylhex-2-enimidoyl fluoride.
| Compound Name | (Z)-N,4-dimethylhex-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 155728645 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (Z)-N,4-dimethylhex-2-enimidoyl fluoride |
| SMILES | CCC(C)/C=C\C(F)=N\C |
| InChI | InChI=1S/C8H14FN/c1-4-7(2)5-6-8(9)10-3/h5-7H,4H2,1-3H3/b6-5-,10-8- |
| InChIKey | KJMRKYDYCDJJLC-XUTLIFGGSA-N |
| XLogP | 2.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|