(Z)-N,4-dimethylhex-2-enimidoyl fluoride

C8H14FN — CID 155728645

IUPAC(Z)-N,4-dimethylhex-2-enimidoyl fluoride
SMILESCCC(C)/C=C\C(F)=N\C
InChIInChI=1S/C8H14FN/c1-4-7(2)5-6-8(9)10-3/h5-7H,4H2,1-3H3/b6-5-,10-8-
InChIKeyKJMRKYDYCDJJLC-XUTLIFGGSA-N
MW143.20 g/mol
LogP2.59
Rot. Bonds3

About (Z)-N,4-dimethylhex-2-enimidoyl fluoride

(Z)-N,4-dimethylhex-2-enimidoyl fluoride (PubChem CID 155728645) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z)-N,4-dimethylhex-2-enimidoyl fluoride.

Molecular Properties

Compound Name(Z)-N,4-dimethylhex-2-enimidoyl fluoride
PubChem CID155728645
Molecular FormulaC8H14FN
Molecular Weight143.20 g/mol
Exact Mass143.11
IUPAC Name(Z)-N,4-dimethylhex-2-enimidoyl fluoride
SMILESCCC(C)/C=C\C(F)=N\C
InChIInChI=1S/C8H14FN/c1-4-7(2)5-6-8(9)10-3/h5-7H,4H2,1-3H3/b6-5-,10-8-
InChIKeyKJMRKYDYCDJJLC-XUTLIFGGSA-N
XLogP2.59
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.20
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (Z)-N,4-dimethylhex-2-enimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N,4-dimethylhex-2-enimidoyl fluoride?
The IUPAC name of (Z)-N,4-dimethylhex-2-enimidoyl fluoride (CID 155728645) is (Z)-N,4-dimethylhex-2-enimidoyl fluoride.
What is the SMILES notation for (Z)-N,4-dimethylhex-2-enimidoyl fluoride?
The canonical SMILES for (Z)-N,4-dimethylhex-2-enimidoyl fluoride is CCC(C)/C=C\C(F)=N\C.
What is the InChIKey of (Z)-N,4-dimethylhex-2-enimidoyl fluoride?
The InChIKey is KJMRKYDYCDJJLC-XUTLIFGGSA-N. The full InChI is InChI=1S/C8H14FN/c1-4-7(2)5-6-8(9)10-3/h5-7H,4H2,1-3H3/b6-5-,10-8-.
What are the key properties of (Z)-N,4-dimethylhex-2-enimidoyl fluoride?
(Z)-N,4-dimethylhex-2-enimidoyl fluoride has a molecular weight of 143.20 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,4-dimethylhex-2-enimidoyl fluoride is sourced from PubChem (CID 155728645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).