C9H16FN — CID 142523799
(E)-4-fluoro-N,2-dimethylhept-4-en-3-imine (PubChem CID 142523799) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (E)-4-fluoro-N,2-dimethylhept-4-en-3-imine.
| Compound Name | (E)-4-fluoro-N,2-dimethylhept-4-en-3-imine |
|---|---|
| PubChem CID | 142523799 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (E)-4-fluoro-N,2-dimethylhept-4-en-3-imine |
| SMILES | CC/C=C(F)\C(=N\C)C(C)C |
| InChI | InChI=1S/C9H16FN/c1-5-6-8(10)9(11-4)7(2)3/h6-7H,5H2,1-4H3/b8-6+,11-9+ |
| InChIKey | DFMFPUCUXCWKLP-ZOIFJEAISA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|