C17H27N — CID 70505819
(4E,8E)-11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene (PubChem CID 70505819) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (4E,8E)-11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene.
| Compound Name | (4E,8E)-11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 70505819 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (4E,8E)-11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene |
| SMILES | CC=CC(C)C1C/C=C/CC/C=C/CC(C)/C=N/1 |
| InChI | InChI=1S/C17H27N/c1-4-11-16(3)17-13-10-8-6-5-7-9-12-15(2)14-18-17/h4,7-11,14-17H,5-6,12-13H2,1-3H3/b9-7+,10-8+,11-4?,18-14+ |
| InChIKey | MICKYOBSRYQTBZ-BMDADPISSA-N |
| XLogP | 4.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|