C16H27N — CID 5371390
2-methyl-N-[(5E)-2-methylundeca-5,10-dien-3-yl]prop-2-en-1-imine (PubChem CID 5371390) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-methyl-N-[(5E)-2-methylundeca-5,10-dien-3-yl]prop-2-en-1-imine.
| Compound Name | 2-methyl-N-[(5E)-2-methylundeca-5,10-dien-3-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 5371390 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 2-methyl-N-[(5E)-2-methylundeca-5,10-dien-3-yl]prop-2-en-1-imine |
| SMILES | C=CCCC/C=C/CC(/N=C/C(=C)C)C(C)C |
| InChI | InChI=1S/C16H27N/c1-6-7-8-9-10-11-12-16(15(4)5)17-13-14(2)3/h6,10-11,13,15-16H,1-2,7-9,12H2,3-5H3/b11-10+,17-13+ |
| InChIKey | IAYXEHZIRZLEFF-DWLYSLLYSA-N |
| XLogP | 4.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|