C16H27N — CID 557512
11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene (PubChem CID 557512) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene.
| Compound Name | 11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 557512 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene |
| SMILES | CC(C)C1CC=CCCC=CCC(C)(C)/C=N\1 |
| InChI | InChI=1S/C16H27N/c1-14(2)15-11-9-7-5-6-8-10-12-16(3,4)13-17-15/h7-10,13-15H,5-6,11-12H2,1-4H3/b9-7?,10-8?,17-13- |
| InChIKey | BUAVBORLHRCLMY-XMQMPUBBSA-N |
| XLogP | 4.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|