C21H28F3N — CID 132558871
(2Z,4E,6E,8E)-N,7-dimethyl-3-(trifluoromethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 132558871) has the molecular formula C21H28F3N and a molecular weight of 351.46 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-N,7-dimethyl-3-(trifluoromethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2Z,4E,6E,8E)-N,7-dimethyl-3-(trifluoromethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 132558871 |
| Molecular Formula | C21H28F3N |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2Z,4E,6E,8E)-N,7-dimethyl-3-(trifluoromethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | C/N=C/C=C(/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C(F)(F)F |
| InChI | InChI=1S/C21H28F3N/c1-16(8-6-10-18(13-15-25-5)21(22,23)24)11-12-19-17(2)9-7-14-20(19,3)4/h6,8,10-13,15H,7,9,14H2,1-5H3/b10-6+,12-11+,16-8+,18-13-,25-15+ |
| InChIKey | JISZWBFSUBBXJV-SDCLGLSLSA-N |
| XLogP | 6.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|