C17H33N — CID 91514795
5-ethyl-N,2-dimethyltridec-2-en-1-imine (PubChem CID 91514795) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 5-ethyl-N,2-dimethyltridec-2-en-1-imine.
| Compound Name | 5-ethyl-N,2-dimethyltridec-2-en-1-imine |
|---|---|
| PubChem CID | 91514795 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 5-ethyl-N,2-dimethyltridec-2-en-1-imine |
| SMILES | CCCCCCCCC(CC)CC=C(C)/C=N/C |
| InChI | InChI=1S/C17H33N/c1-5-7-8-9-10-11-12-17(6-2)14-13-16(3)15-18-4/h13,15,17H,5-12,14H2,1-4H3/b16-13?,18-15+ |
| InChIKey | ZDYGQTRUHYRINY-IVUDFJMXSA-N |
| XLogP | 5.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|