C23H37N — CID 91261335
2,5-dimethyl-2-[[4-(5-methyl-2-methylidenehex-5-enyl)cycloheptyl]methyl]-3H-pyridine (PubChem CID 91261335) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is 2,5-dimethyl-2-[[4-(5-methyl-2-methylidenehex-5-enyl)cycloheptyl]methyl]-3H-pyridine.
| Compound Name | 2,5-dimethyl-2-[[4-(5-methyl-2-methylidenehex-5-enyl)cycloheptyl]methyl]-3H-pyridine |
|---|---|
| PubChem CID | 91261335 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | 2,5-dimethyl-2-[[4-(5-methyl-2-methylidenehex-5-enyl)cycloheptyl]methyl]-3H-pyridine |
| SMILES | C=C(C)CCC(=C)CC1CCCC(CC2(C)CC=C(C)C=N2)CC1 |
| InChI | InChI=1S/C23H37N/c1-18(2)9-10-19(3)15-21-7-6-8-22(12-11-21)16-23(5)14-13-20(4)17-24-23/h13,17,21-22H,1,3,6-12,14-16H2,2,4-5H3 |
| InChIKey | WJQIPWQFQQWYBN-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|