C14H25N — CID 90902116
5-ethyl-2-heptan-4-yl-2,3-dihydropyridine (PubChem CID 90902116) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 5-ethyl-2-heptan-4-yl-2,3-dihydropyridine.
| Compound Name | 5-ethyl-2-heptan-4-yl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 90902116 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 5-ethyl-2-heptan-4-yl-2,3-dihydropyridine |
| SMILES | CCCC(CCC)C1CC=C(CC)C=N1 |
| InChI | InChI=1S/C14H25N/c1-4-7-13(8-5-2)14-10-9-12(6-3)11-15-14/h9,11,13-14H,4-8,10H2,1-3H3 |
| InChIKey | LLPGQVDNXLALKT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |