C16H29N — CID 90769610
3-(2-methylbutylidene)-4-propyl-2,4,5,6,7,8-hexahydroazonine (PubChem CID 90769610) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 3-(2-methylbutylidene)-4-propyl-2,4,5,6,7,8-hexahydroazonine.
| Compound Name | 3-(2-methylbutylidene)-4-propyl-2,4,5,6,7,8-hexahydroazonine |
|---|---|
| PubChem CID | 90769610 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 3-(2-methylbutylidene)-4-propyl-2,4,5,6,7,8-hexahydroazonine |
| SMILES | CCCC1CCCC/C=N\CC1=CC(C)CC |
| InChI | InChI=1S/C16H29N/c1-4-9-15-10-7-6-8-11-17-13-16(15)12-14(3)5-2/h11-12,14-15H,4-10,13H2,1-3H3/b16-12?,17-11- |
| InChIKey | LFJSTCUJLXGMKR-DBZPOCDUSA-N |
| XLogP | 5.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|