C13H21N — CID 57316002
3-cyclooctyl-2,5-dihydropyridine (PubChem CID 57316002) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-cyclooctyl-2,5-dihydropyridine.
| Compound Name | 3-cyclooctyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 57316002 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-cyclooctyl-2,5-dihydropyridine |
| SMILES | C1=NCC(C2CCCCCCC2)=CC1 |
| InChI | InChI=1S/C13H21N/c1-2-4-7-12(8-5-3-1)13-9-6-10-14-11-13/h9-10,12H,1-8,11H2 |
| InChIKey | UYZRCACSYSFBIW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|