C22H33N — CID 100913984
(2E,4E,6E,8E)-N-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 100913984) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E,8E)-N-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 100913984 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (2E,4E,6E,8E)-N-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CC/N=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H33N/c1-7-23-17-15-19(3)11-8-10-18(2)13-14-21-20(4)12-9-16-22(21,5)6/h8,10-11,13-15,17H,7,9,12,16H2,1-6H3/b11-8+,14-13+,18-10+,19-15+,23-17+ |
| InChIKey | BIKQKQOYHNJRBP-DQCGJCGASA-N |
| XLogP | 6.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|