C16H23N — CID 155467875
3-(2,2-dimethylhexyl)-3aH-indole (PubChem CID 155467875) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-(2,2-dimethylhexyl)-3aH-indole.
| Compound Name | 3-(2,2-dimethylhexyl)-3aH-indole |
|---|---|
| PubChem CID | 155467875 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-(2,2-dimethylhexyl)-3aH-indole |
| SMILES | CCCCC(C)(C)CC1=CN=C2C=CC=CC12 |
| InChI | InChI=1S/C16H23N/c1-4-5-10-16(2,3)11-13-12-17-15-9-7-6-8-14(13)15/h6-9,12,14H,4-5,10-11H2,1-3H3 |
| InChIKey | WDFWQMMGNSTPNU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |