C15H19N — CID 145123078
3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine (PubChem CID 145123078) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine.
| Compound Name | 3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine |
|---|---|
| PubChem CID | 145123078 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine |
| SMILES | C=CC1C(/C=C\C)/C(=N/C)C2C=CC=CC21 |
| InChI | InChI=1S/C15H19N/c1-4-8-13-11(5-2)12-9-6-7-10-14(12)15(13)16-3/h4-14H,2H2,1,3H3/b8-4-,16-15- |
| InChIKey | BYEPNRKSTCVOEW-CETIGSGPSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|