C14H17N — CID 145284089
3-ethenyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine (PubChem CID 145284089) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-ethenyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine.
| Compound Name | 3-ethenyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine |
|---|---|
| PubChem CID | 145284089 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-ethenyl-2-[(Z)-prop-1-enyl]-2,3,3a,7a-tetrahydroinden-1-imine |
| SMILES | [H]/N=C1\C2C=CC=CC2C(C=C)C1/C=C\C |
| InChI | InChI=1S/C14H17N/c1-3-7-12-10(4-2)11-8-5-6-9-13(11)14(12)15/h3-13,15H,2H2,1H3/b7-3-,15-14- |
| InChIKey | FDLYWJZISOPUFG-KQUZNIQSSA-N |
| XLogP | 3.37 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|