C13H13N — CID 134170096
4a,4b,8a,9a-tetrahydrofluoren-9-imine (PubChem CID 134170096) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 4a,4b,8a,9a-tetrahydrofluoren-9-imine.
| Compound Name | 4a,4b,8a,9a-tetrahydrofluoren-9-imine |
|---|---|
| PubChem CID | 134170096 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4a,4b,8a,9a-tetrahydrofluoren-9-imine |
| SMILES | [H]N=C1C2C=CC=CC2C2C=CC=CC12 |
| InChI | InChI=1S/C13H13N/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-12,14H |
| InChIKey | IAJSAUSSKMZETJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|