C12H19N — CID 167052556
N,2-dimethyl-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-imine (PubChem CID 167052556) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N,2-dimethyl-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-imine.
| Compound Name | N,2-dimethyl-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 167052556 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N,2-dimethyl-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-imine |
| SMILES | C/N=C(\C(C)C)C1C=CC=CC1C |
| InChI | InChI=1S/C12H19N/c1-9(2)12(13-4)11-8-6-5-7-10(11)3/h5-11H,1-4H3/b13-12+ |
| InChIKey | MDSYZNMKDVWCHB-OUKQBFOZSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|