C16H27N — CID 123545015
3,3-dimethyl-2-(4-methylpentyl)-2,3a,4,5-tetrahydroindole (PubChem CID 123545015) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 3,3-dimethyl-2-(4-methylpentyl)-2,3a,4,5-tetrahydroindole.
| Compound Name | 3,3-dimethyl-2-(4-methylpentyl)-2,3a,4,5-tetrahydroindole |
|---|---|
| PubChem CID | 123545015 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3,3-dimethyl-2-(4-methylpentyl)-2,3a,4,5-tetrahydroindole |
| SMILES | CC(C)CCCC1N=C2C=CCCC2C1(C)C |
| InChI | InChI=1S/C16H27N/c1-12(2)8-7-11-15-16(3,4)13-9-5-6-10-14(13)17-15/h6,10,12-13,15H,5,7-9,11H2,1-4H3 |
| InChIKey | GYYINKCFGHSNOX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |