About 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole
2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole (PubChem CID 59346769) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole.
Molecular Properties
| Compound Name | 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole |
| PubChem CID | 59346769 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CC1C(C(C)(C)C)=NC2C=CC=CC21 |
| InChI | InChI=1S/C13H19N/c1-9-10-7-5-6-8-11(10)14-12(9)13(2,3)4/h5-11H,1-4H3 |
| InChIKey | PWWQJSKCQNCONN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole?
The IUPAC name of 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole (CID 59346769) is 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole.
What is the SMILES notation for 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole?
The canonical SMILES for 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole is CC1C(C(C)(C)C)=NC2C=CC=CC21.
What is the InChIKey of 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole?
The InChIKey is PWWQJSKCQNCONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-9-10-7-5-6-8-11(10)14-12(9)13(2,3)4/h5-11H,1-4H3.
What are the key properties of 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole?
2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole has a molecular weight of 189.30 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole is sourced from PubChem (CID 59346769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).