C13H19N — CID 59346769
2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole (PubChem CID 59346769) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole.
| Compound Name | 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 59346769 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-tert-butyl-3-methyl-3a,7a-dihydro-3H-indole |
| SMILES | CC1C(C(C)(C)C)=NC2C=CC=CC21 |
| InChI | InChI=1S/C13H19N/c1-9-10-7-5-6-8-11(10)14-12(9)13(2,3)4/h5-11H,1-4H3 |
| InChIKey | PWWQJSKCQNCONN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |