C25H32N2 — CID 143056595
3-[[6-[(2R)-2-(cyclohexen-1-yl)butyl]-1-azacyclohepta-1,3,4-trien-3-yl]methyl]-4,5-dihydro-3H-indole (PubChem CID 143056595) has the molecular formula C25H32N2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 3-[[6-[(2R)-2-(cyclohexen-1-yl)butyl]-1-azacyclohepta-1,3,4-trien-3-yl]methyl]-4,5-dihydro-3H-indole.
| Compound Name | 3-[[6-[(2R)-2-(cyclohexen-1-yl)butyl]-1-azacyclohepta-1,3,4-trien-3-yl]methyl]-4,5-dihydro-3H-indole |
|---|---|
| PubChem CID | 143056595 |
| Molecular Formula | C25H32N2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 3-[[6-[(2R)-2-(cyclohexen-1-yl)butyl]-1-azacyclohepta-1,3,4-trien-3-yl]methyl]-4,5-dihydro-3H-indole |
| SMILES | CC[C@H](CC1C=C=C(CC2C=NC3=C2CCC=C3)C=NC1)C1=CCCCC1 |
| InChI | InChI=1S/C25H32N2/c1-2-21(22-8-4-3-5-9-22)14-19-12-13-20(17-26-16-19)15-23-18-27-25-11-7-6-10-24(23)25/h7-8,11-12,17-19,21,23H,2-6,9-10,14-16H2,1H3/t19?,21-,23?/m1/s1 |
| InChIKey | HUBPJFNTWDRQCU-YUVVGHDESA-N |
| XLogP | 6.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|