C16H18N2 — CID 155387797
(5Z)-4,8-diazatetracyclo[9.6.1.02,9.03,15]octadeca-1,3,5,7,9-pentaene (PubChem CID 155387797) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (5Z)-4,8-diazatetracyclo[9.6.1.02,9.03,15]octadeca-1,3,5,7,9-pentaene.
| Compound Name | (5Z)-4,8-diazatetracyclo[9.6.1.02,9.03,15]octadeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 155387797 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (5Z)-4,8-diazatetracyclo[9.6.1.02,9.03,15]octadeca-1,3,5,7,9-pentaene |
| SMILES | C1=C2/N=C\C=C/N=C3\C2=C2CCC3CCCC1C2 |
| InChI | InChI=1S/C16H18N2/c1-3-11-9-13-6-5-12(4-1)16-15(13)14(10-11)17-7-2-8-18-16/h2,7-8,10-12H,1,3-6,9H2/b8-2-,17-7-,18-16- |
| InChIKey | FEQFOLLLVKPZOE-LVICZVFFSA-N |
| XLogP | 3.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |