C23H29N — CID 169177312
4-cyclooctyl-2-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydroquinoline (PubChem CID 169177312) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is 4-cyclooctyl-2-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydroquinoline.
| Compound Name | 4-cyclooctyl-2-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 169177312 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-cyclooctyl-2-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydroquinoline |
| SMILES | C=C/C=C(\C=C)c1cc(C2CCCCCCC2)c2c(n1)=CCCC=2 |
| InChI | InChI=1S/C23H29N/c1-3-12-18(4-2)23-17-21(19-13-8-6-5-7-9-14-19)20-15-10-11-16-22(20)24-23/h3-4,12,15-17,19H,1-2,5-11,13-14H2/b18-12+ |
| InChIKey | HTSAESMELIVLBA-LDADJPATSA-N |
| XLogP | 5.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|