C12H15N — CID 91413067
2-ethenyl-6-methyl-4,6,7,8-tetrahydroquinoline (PubChem CID 91413067) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-ethenyl-6-methyl-4,6,7,8-tetrahydroquinoline.
| Compound Name | 2-ethenyl-6-methyl-4,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 91413067 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-ethenyl-6-methyl-4,6,7,8-tetrahydroquinoline |
| SMILES | C=CC1=CCC2=CC(C)CCC2=N1 |
| InChI | InChI=1S/C12H15N/c1-3-11-6-5-10-8-9(2)4-7-12(10)13-11/h3,6,8-9H,1,4-5,7H2,2H3 |
| InChIKey | QDYIDXSJPJPOBX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |