C11H13N — CID 89423862
2-ethyl-4,4a-dihydroquinoline (PubChem CID 89423862) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-ethyl-4,4a-dihydroquinoline.
| Compound Name | 2-ethyl-4,4a-dihydroquinoline |
|---|---|
| PubChem CID | 89423862 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-ethyl-4,4a-dihydroquinoline |
| SMILES | CCC1=CCC2C=CC=CC2=N1 |
| InChI | InChI=1S/C11H13N/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h3-6,8-9H,2,7H2,1H3 |
| InChIKey | YGYULHRFSBMSAG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |