C11H13N — CID 58717366
1,6-dimethyl-6,7-dihydroisoquinoline (PubChem CID 58717366) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,6-dimethyl-6,7-dihydroisoquinoline.
| Compound Name | 1,6-dimethyl-6,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 58717366 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,6-dimethyl-6,7-dihydroisoquinoline |
| SMILES | Cc1nccc2c1=CCC(C)C=2 |
| InChI | InChI=1S/C11H13N/c1-8-3-4-11-9(2)12-6-5-10(11)7-8/h4-8H,3H2,1-2H3 |
| InChIKey | SPBDNVYYGTUDEE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |