C13H14F3N — CID 143910935
6-ethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydroquinoline (PubChem CID 143910935) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is 6-ethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydroquinoline.
| Compound Name | 6-ethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydroquinoline |
|---|---|
| PubChem CID | 143910935 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-ethyl-2-(2,2,2-trifluoroethyl)-6,7-dihydroquinoline |
| SMILES | CCC1C=c2ccc(CC(F)(F)F)nc2=CC1 |
| InChI | InChI=1S/C13H14F3N/c1-2-9-3-6-12-10(7-9)4-5-11(17-12)8-13(14,15)16/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | VSWNNONMIZCGEM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |