C11H11F6N — CID 150480476
2,6-dimethyl-3,5-bis(2,2,2-trifluoroethyl)pyridine (PubChem CID 150480476) has the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. Its IUPAC name is 2,6-dimethyl-3,5-bis(2,2,2-trifluoroethyl)pyridine.
| Compound Name | 2,6-dimethyl-3,5-bis(2,2,2-trifluoroethyl)pyridine |
|---|---|
| PubChem CID | 150480476 |
| Molecular Formula | C11H11F6N |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2,6-dimethyl-3,5-bis(2,2,2-trifluoroethyl)pyridine |
| SMILES | Cc1nc(C)c(CC(F)(F)F)cc1CC(F)(F)F |
| InChI | InChI=1S/C11H11F6N/c1-6-8(4-10(12,13)14)3-9(7(2)18-6)5-11(15,16)17/h3H,4-5H2,1-2H3 |
| InChIKey | HTSFTMJNSUBPJI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |