C8H8ClF3N2 — CID 131115505
4-chloro-2-ethyl-5-(2,2,2-trifluoroethyl)pyrimidine (PubChem CID 131115505) has the molecular formula C8H8ClF3N2 and a molecular weight of 224.61 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5-(2,2,2-trifluoroethyl)pyrimidine.
| Compound Name | 4-chloro-2-ethyl-5-(2,2,2-trifluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 131115505 |
| Molecular Formula | C8H8ClF3N2 |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 4-chloro-2-ethyl-5-(2,2,2-trifluoroethyl)pyrimidine |
| SMILES | CCc1ncc(CC(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C8H8ClF3N2/c1-2-6-13-4-5(7(9)14-6)3-8(10,11)12/h4H,2-3H2,1H3 |
| InChIKey | GVPZZJQORAGXDC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |