C8H10F2N2O — CID 130482994
[4-(difluoromethyl)-2-ethylpyrimidin-5-yl]methanol (PubChem CID 130482994) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is [4-(difluoromethyl)-2-ethylpyrimidin-5-yl]methanol.
| Compound Name | [4-(difluoromethyl)-2-ethylpyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 130482994 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | [4-(difluoromethyl)-2-ethylpyrimidin-5-yl]methanol |
| SMILES | CCc1ncc(CO)c(C(F)F)n1 |
| InChI | InChI=1S/C8H10F2N2O/c1-2-6-11-3-5(4-13)7(12-6)8(9)10/h3,8,13H,2,4H2,1H3 |
| InChIKey | JLZJWNQJOQITQI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |